C15H34OSi2 — CID 18336148
1,1,2,2,3,3,4,4,5,6,6-undecamethyl-1,3-disilinan-5-ol (PubChem CID 18336148) has the molecular formula C15H34OSi2 and a molecular weight of 286.61 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,6-undecamethyl-1,3-disilinan-5-ol.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,6-undecamethyl-1,3-disilinan-5-ol |
|---|---|
| PubChem CID | 18336148 |
| Molecular Formula | C15H34OSi2 |
| Molecular Weight | 286.61 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,6-undecamethyl-1,3-disilinan-5-ol |
| SMILES | CC1(O)C(C)(C)[Si](C)(C)C(C)(C)[Si](C)(C)C1(C)C |
| InChI | InChI=1S/C15H34OSi2/c1-12(2)15(7,16)13(3,4)18(10,11)14(5,6)17(12,8)9/h16H,1-11H3 |
| InChIKey | MZTVEIYEUWJISG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|