About 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one
5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (PubChem CID 18336187) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
Molecular Properties
| Compound Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| PubChem CID | 18336187 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| SMILES | CC1C2CC(C1C)C1(COC(=O)C1)C2 |
| InChI | InChI=1S/C12H18O2/c1-7-8(2)10-3-9(7)4-12(10)5-11(13)14-6-12/h7-10H,3-6H2,1-2H3 |
| InChIKey | HCEPTAWLXPPADR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The IUPAC name of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (CID 18336187) is 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
What is the SMILES notation for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The canonical SMILES for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one is CC1C2CC(C1C)C1(COC(=O)C1)C2.
What is the InChIKey of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The InChIKey is HCEPTAWLXPPADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-7-8(2)10-3-9(7)4-12(10)5-11(13)14-6-12/h7-10H,3-6H2,1-2H3.
What are the key properties of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one has a molecular weight of 194.27 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one is sourced from PubChem (CID 18336187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).