About 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one
3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one (PubChem CID 18336225) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one.
Molecular Properties
| Compound Name | 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one |
| PubChem CID | 18336225 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one |
| SMILES | CC1C2CC(CCC3CCOC3=O)C(C2)C1C |
| InChI | InChI=1S/C15H24O2/c1-9-10(2)14-8-13(9)7-12(14)4-3-11-5-6-17-15(11)16/h9-14H,3-8H2,1-2H3 |
| InChIKey | VVDKHQSHCFOSBR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one?
The IUPAC name of 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one (CID 18336225) is 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one.
What is the SMILES notation for 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one?
The canonical SMILES for 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one is CC1C2CC(CCC3CCOC3=O)C(C2)C1C.
What is the InChIKey of 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one?
The InChIKey is VVDKHQSHCFOSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-9-10(2)14-8-13(9)7-12(14)4-3-11-5-6-17-15(11)16/h9-14H,3-8H2,1-2H3.
What are the key properties of 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one?
3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one has a molecular weight of 236.35 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethyl]oxolan-2-one is sourced from PubChem (CID 18336225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).