About 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate
2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 18336244) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 18336244 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(C)OC(=O)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C15H26O2/c1-6-15(4,5)17-14(16)13-8-11-7-12(13)10(3)9(11)2/h9-13H,6-8H2,1-5H3 |
| InChIKey | KHKNRPGRZQYEHE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (CID 18336244) is 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate is CCC(C)(C)OC(=O)C1CC2CC1C(C)C2C.
What is the InChIKey of 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is KHKNRPGRZQYEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-6-15(4,5)17-14(16)13-8-11-7-12(13)10(3)9(11)2/h9-13H,6-8H2,1-5H3.
What are the key properties of 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 238.37 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 18336244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).