About 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate (PubChem CID 18336270) has the molecular formula C19H28O8
and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate |
| PubChem CID | 18336270 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)OC1CCC2CC1OC2=O |
| InChI | InChI=1S/C19H28O8/c1-4-19(2,3)18(23)25-10-9-24-15(20)7-8-16(21)26-13-6-5-12-11-14(13)27-17(12)22/h12-14H,4-11H2,1-3H3 |
| InChIKey | AAEVZEILJSUBLP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate?
The IUPAC name of 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate (CID 18336270) is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate.
What is the SMILES notation for 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate?
The canonical SMILES for 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate is CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)OC1CCC2CC1OC2=O.
What is the InChIKey of 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate?
The InChIKey is AAEVZEILJSUBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O8/c1-4-19(2,3)18(23)25-10-9-24-15(20)7-8-16(21)26-13-6-5-12-11-14(13)27-17(12)22/h12-14H,4-11H2,1-3H3.
What are the key properties of 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate?
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate has a molecular weight of 384.43 g/mol, XLogP of 1.93, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) butanedioate is sourced from PubChem (CID 18336270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).