About [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate
[3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate (PubChem CID 18336278) has the molecular formula C17H26O6
and a molecular weight of 326.39 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate |
| PubChem CID | 18336278 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC(=O)OC1C(C)CC2CC1(C)OC2=O |
| InChI | InChI=1S/C17H26O6/c1-5-10(2)15(19)21-7-6-13(18)22-14-11(3)8-12-9-17(14,4)23-16(12)20/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | SJIWZXZPPOMKQO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate?
The IUPAC name of [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate (CID 18336278) is [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate.
What is the SMILES notation for [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate?
The canonical SMILES for [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate is CCC(C)C(=O)OCCC(=O)OC1C(C)CC2CC1(C)OC2=O.
What is the InChIKey of [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate?
The InChIKey is SJIWZXZPPOMKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O6/c1-5-10(2)15(19)21-7-6-13(18)22-14-11(3)8-12-9-17(14,4)23-16(12)20/h10-12,14H,5-9H2,1-4H3.
What are the key properties of [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate?
[3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate has a molecular weight of 326.39 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]-3-oxopropyl] 2-methylbutanoate is sourced from PubChem (CID 18336278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).