About 3-pyrrolidin-3-yl-1,2-oxazole
3-pyrrolidin-3-yl-1,2-oxazole (PubChem CID 18337183) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-pyrrolidin-3-yl-1,2-oxazole |
| PubChem CID | 18337183 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-pyrrolidin-3-yl-1,2-oxazole |
| SMILES | c1cc(C2CCNC2)no1 |
| InChI | InChI=1S/C7H10N2O/c1-3-8-5-6(1)7-2-4-10-9-7/h2,4,6,8H,1,3,5H2 |
| InChIKey | UPYSXYBXOWPKLL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyrrolidin-3-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-3-yl-1,2-oxazole?
The IUPAC name of 3-pyrrolidin-3-yl-1,2-oxazole (CID 18337183) is 3-pyrrolidin-3-yl-1,2-oxazole.
What is the SMILES notation for 3-pyrrolidin-3-yl-1,2-oxazole?
The canonical SMILES for 3-pyrrolidin-3-yl-1,2-oxazole is c1cc(C2CCNC2)no1.
What is the InChIKey of 3-pyrrolidin-3-yl-1,2-oxazole?
The InChIKey is UPYSXYBXOWPKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-3-8-5-6(1)7-2-4-10-9-7/h2,4,6,8H,1,3,5H2.
What are the key properties of 3-pyrrolidin-3-yl-1,2-oxazole?
3-pyrrolidin-3-yl-1,2-oxazole has a molecular weight of 138.17 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-3-yl-1,2-oxazole is sourced from PubChem (CID 18337183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).