C26H23F5N6O3 — CID 18337784
4-[1-[(1S,3R)-3-aminocyclopentyl]-5-fluoroindol-3-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 18337784) has the molecular formula C26H23F5N6O3 and a molecular weight of 562.50 g/mol. Its IUPAC name is 4-[1-[(1S,3R)-3-aminocyclopentyl]-5-fluoroindol-3-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[1-[(1S,3R)-3-aminocyclopentyl]-5-fluoroindol-3-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18337784 |
| Molecular Formula | C26H23F5N6O3 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 4-[1-[(1S,3R)-3-aminocyclopentyl]-5-fluoroindol-3-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(-c2n[nH]c(=O)n2-c2cn([C@H]3CC[C@@H](N)C3)c3ccc(F)cc23)c2cc(F)ccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H22F2N6O.C2HF3O2/c1-30-11-19(17-8-13(25)2-6-20(17)30)23-28-29-24(33)32(23)22-12-31(16-5-4-15(27)10-16)21-7-3-14(26)9-18(21)22;3-2(4,5)1(6)7/h2-3,6-9,11-12,15-16H,4-5,10,27H2,1H3,(H,29,33);(H,6,7)/t15-,16+;/m1./s1 |
| InChIKey | GHYQOQXKQYZUBF-RCPFAERMSA-N |
| XLogP | 4.64 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |