C10H17N3O2 — CID 18338699
2,7,7-trimethyl-3,4,8,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 18338699) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2,7,7-trimethyl-3,4,8,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2,7,7-trimethyl-3,4,8,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 18338699 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2,7,7-trimethyl-3,4,8,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN1CCN2C(=O)C(C)(C)NC(=O)C2C1 |
| InChI | InChI=1S/C10H17N3O2/c1-10(2)9(15)13-5-4-12(3)6-7(13)8(14)11-10/h7H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | PRPOITZXZPRDNX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |