C4H10BNO2 — CID 18339117
2,5-dimethyl-1,3,5,2-dioxazaborinane (PubChem CID 18339117) has the molecular formula C4H10BNO2 and a molecular weight of 114.94 g/mol. Its IUPAC name is 2,5-dimethyl-1,3,5,2-dioxazaborinane.
| Compound Name | 2,5-dimethyl-1,3,5,2-dioxazaborinane |
|---|---|
| PubChem CID | 18339117 |
| Molecular Formula | C4H10BNO2 |
| Molecular Weight | 114.94 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 2,5-dimethyl-1,3,5,2-dioxazaborinane |
| SMILES | CB1OCN(C)CO1 |
| InChI | InChI=1S/C4H10BNO2/c1-5-7-3-6(2)4-8-5/h3-4H2,1-2H3 |
| InChIKey | IPAXPHVJFBRVGX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.94 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|