C10H16S — CID 18339224
3,4,6,7-tetramethyl-2,5-dihydrothiepine (PubChem CID 18339224) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 3,4,6,7-tetramethyl-2,5-dihydrothiepine.
| Compound Name | 3,4,6,7-tetramethyl-2,5-dihydrothiepine |
|---|---|
| PubChem CID | 18339224 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3,4,6,7-tetramethyl-2,5-dihydrothiepine |
| SMILES | CC1=C(C)CC(C)=C(C)SC1 |
| InChI | InChI=1S/C10H16S/c1-7-5-8(2)10(4)11-6-9(7)3/h5-6H2,1-4H3 |
| InChIKey | SKHRGSHWLDXHSA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|