C19H22N2O2 — CID 18339391
4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)naphthalen-1-olate (PubChem CID 18339391) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)naphthalen-1-olate.
| Compound Name | 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)naphthalen-1-olate |
|---|---|
| PubChem CID | 18339391 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)naphthalen-1-olate |
| SMILES | [O-]c1c(N2CCC[N+]3=C2CCCCC3)cc(O)c2ccccc12 |
| InChI | InChI=1S/C19H22N2O2/c22-17-13-16(19(23)15-8-4-3-7-14(15)17)21-12-6-11-20-10-5-1-2-9-18(20)21/h3-4,7-8,13H,1-2,5-6,9-12H2,(H-,22,23) |
| InChIKey | NKOSYIQFEBYPNE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|