C47H44F8O2 — CID 18339407
1-[4-[(E)-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]phenyl]-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(4-methylphenyl)phenyl]benzene (PubChem CID 18339407) has the molecular formula C47H44F8O2 and a molecular weight of 792.85 g/mol. Its IUPAC name is 1-[4-[(E)-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]phenyl]-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(4-methylphenyl)phenyl]benzene.
| Compound Name | 1-[4-[(E)-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]phenyl]-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(4-methylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 18339407 |
| Molecular Formula | C47H44F8O2 |
| Molecular Weight | 792.85 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | 1-[4-[(E)-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]phenyl]-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(4-methylphenyl)phenyl]benzene |
| SMILES | C/C=C/c1cc(OC)c(/C=C/c2ccc(-c3c(F)c(F)c(-c4c(F)c(F)c(-c5ccc(C)cc5)c(F)c4F)c(F)c3F)cc2)cc1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C47H44F8O2/c1-7-9-32-24-34(56-6)33(25-35(32)57-23-22-27(4)11-8-10-26(2)3)21-16-29-14-19-31(20-15-29)37-42(50)46(54)39(47(55)43(37)51)38-44(52)40(48)36(41(49)45(38)53)30-17-12-28(5)13-18-30/h7,9,12-21,24-27H,8,10-11,22-23H2,1-6H3/b9-7+,21-16+ |
| InChIKey | RYKHYTKZUHKQKL-GVJPDHINSA-N |
| XLogP | 14.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.85 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|