C28H30Cl2N4O5 — CID 18339605
(4-ethyl-2,6-dimethylcyclohexyl) 5-(2,6-dichlorobenzoyl)oxy-6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18339605) has the molecular formula C28H30Cl2N4O5 and a molecular weight of 573.48 g/mol. Its IUPAC name is (4-ethyl-2,6-dimethylcyclohexyl) 5-(2,6-dichlorobenzoyl)oxy-6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (4-ethyl-2,6-dimethylcyclohexyl) 5-(2,6-dichlorobenzoyl)oxy-6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18339605 |
| Molecular Formula | C28H30Cl2N4O5 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | (4-ethyl-2,6-dimethylcyclohexyl) 5-(2,6-dichlorobenzoyl)oxy-6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(CC)CC2C)c2nc(C(C)(C)C=O)[nH]n2c1OC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H30Cl2N4O5/c1-7-16-11-14(2)22(15(3)12-16)38-26(37)20-21(31-6)24(34-23(20)32-27(33-34)28(4,5)13-35)39-25(36)19-17(29)9-8-10-18(19)30/h8-10,13-16,22H,7,11-12H2,1-5H3,(H,32,33) |
| InChIKey | AXCRPHFXZUPVDO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|