C20H28N4 — CID 18339676
2,3,4,10,11,12-hexamethyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene (PubChem CID 18339676) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2,3,4,10,11,12-hexamethyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene.
| Compound Name | 2,3,4,10,11,12-hexamethyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene |
|---|---|
| PubChem CID | 18339676 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2,3,4,10,11,12-hexamethyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene |
| SMILES | CC1c2cccc(n2)C(C)N(C)C(C)c2cccc(n2)C(C)N1C |
| InChI | InChI=1S/C20H28N4/c1-13-17-9-7-10-19(21-17)15(3)24(6)16(4)20-12-8-11-18(22-20)14(2)23(13)5/h7-16H,1-6H3 |
| InChIKey | ZAMZOMYHGFJZST-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |