C13H30N2 — CID 18339679
2-N,2-N,4-N,4-N,2,3,3,4-octamethylpentane-2,4-diamine (PubChem CID 18339679) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,2,3,3,4-octamethylpentane-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N,2,3,3,4-octamethylpentane-2,4-diamine |
|---|---|
| PubChem CID | 18339679 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-N,2-N,4-N,4-N,2,3,3,4-octamethylpentane-2,4-diamine |
| SMILES | CN(C)C(C)(C)C(C)(C)C(C)(C)N(C)C |
| InChI | InChI=1S/C13H30N2/c1-11(2,12(3,4)14(7)8)13(5,6)15(9)10/h1-10H3 |
| InChIKey | ZEENSBVHPNCMBF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |