C17H26NNa2O5P — CID 18339728
disodium;[(1R,2R)-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate (PubChem CID 18339728) has the molecular formula C17H26NNa2O5P and a molecular weight of 401.35 g/mol. Its IUPAC name is disodium;[(1R,2R)-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate.
| Compound Name | disodium;[(1R,2R)-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate |
|---|---|
| PubChem CID | 18339728 |
| Molecular Formula | C17H26NNa2O5P |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | disodium;[(1R,2R)-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate |
| SMILES | CCCCCCCC(=O)N[C@H](c1ccccc1)[C@@H](C)OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H28NO5P.2Na/c1-3-4-5-6-10-13-16(19)18-17(14(2)23-24(20,21)22)15-11-8-7-9-12-15;;/h7-9,11-12,14,17H,3-6,10,13H2,1-2H3,(H,18,19)(H2,20,21,22);;/q;2*+1/p-2/t14-,17+;;/m1../s1 |
| InChIKey | OSNJITGINGKOSX-YSEASCLGSA-L |
| XLogP | -3.55 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|