C22H28NNa2O5P — CID 18339768
disodium;[(1S,2R)-2-(octanoylamino)-1,2-diphenylethyl] phosphate (PubChem CID 18339768) has the molecular formula C22H28NNa2O5P and a molecular weight of 463.42 g/mol. Its IUPAC name is disodium;[(1S,2R)-2-(octanoylamino)-1,2-diphenylethyl] phosphate.
| Compound Name | disodium;[(1S,2R)-2-(octanoylamino)-1,2-diphenylethyl] phosphate |
|---|---|
| PubChem CID | 18339768 |
| Molecular Formula | C22H28NNa2O5P |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | disodium;[(1S,2R)-2-(octanoylamino)-1,2-diphenylethyl] phosphate |
| SMILES | CCCCCCCC(=O)N[C@H](c1ccccc1)[C@@H](OP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H30NO5P.2Na/c1-2-3-4-5-12-17-20(24)23-21(18-13-8-6-9-14-18)22(28-29(25,26)27)19-15-10-7-11-16-19;;/h6-11,13-16,21-22H,2-5,12,17H2,1H3,(H,23,24)(H2,25,26,27);;/q;2*+1/p-2/t21-,22+;;/m1../s1 |
| InChIKey | IUDLQIIDOAFMCN-ZZYOSWMOSA-L |
| XLogP | -2.20 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|