About disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate
disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate (PubChem CID 18339790) has the molecular formula C19H22NNa2O5P
and a molecular weight of 421.34 g/mol. Its IUPAC name is disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate.
Molecular Properties
| Compound Name | disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate |
| PubChem CID | 18339790 |
| Molecular Formula | C19H22NNa2O5P |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate |
| SMILES | O=C(CCCCc1ccccc1)N[C@@H](COP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C19H24NO5P.2Na/c21-19(14-8-7-11-16-9-3-1-4-10-16)20-18(15-25-26(22,23)24)17-12-5-2-6-13-17;;/h1-6,9-10,12-13,18H,7-8,11,14-15H2,(H,20,21)(H2,22,23,24);;/q;2*+1/p-2/t18-;;/m0../s1 |
| InChIKey | ZHSNIEPDPJYDJN-NTEVMMBTSA-L |
| XLogP | -3.89 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate?
The IUPAC name of disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate (CID 18339790) is disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate.
What is the SMILES notation for disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate?
The canonical SMILES for disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate is O=C(CCCCc1ccccc1)N[C@@H](COP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+].
What is the InChIKey of disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate?
The InChIKey is ZHSNIEPDPJYDJN-NTEVMMBTSA-L. The full InChI is InChI=1S/C19H24NO5P.2Na/c21-19(14-8-7-11-16-9-3-1-4-10-16)20-18(15-25-26(22,23)24)17-12-5-2-6-13-17;;/h1-6,9-10,12-13,18H,7-8,11,14-15H2,(H,20,21)(H2,22,23,24);;/q;2*+1/p-2/t18-;;/m0../s1.
What are the key properties of disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate?
disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate has a molecular weight of 421.34 g/mol, XLogP of -3.89, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[(2R)-2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate is sourced from PubChem (CID 18339790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).