About disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate
disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate (PubChem CID 18339794) has the molecular formula C10H12NNa2O5P
and a molecular weight of 303.16 g/mol. Its IUPAC name is disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate.
Molecular Properties
| Compound Name | disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate |
| PubChem CID | 18339794 |
| Molecular Formula | C10H12NNa2O5P |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate |
| SMILES | CC(=O)N[C@@H](COP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C10H14NO5P.2Na/c1-8(12)11-10(7-16-17(13,14)15)9-5-3-2-4-6-9;;/h2-6,10H,7H2,1H3,(H,11,12)(H2,13,14,15);;/q;2*+1/p-2/t10-;;/m0../s1 |
| InChIKey | VKUQGRBLPDJLFI-XRIOVQLTSA-L |
| XLogP | -6.28 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | -6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate?
The IUPAC name of disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate (CID 18339794) is disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate.
What is the SMILES notation for disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate?
The canonical SMILES for disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate is CC(=O)N[C@@H](COP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+].
What is the InChIKey of disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate?
The InChIKey is VKUQGRBLPDJLFI-XRIOVQLTSA-L. The full InChI is InChI=1S/C10H14NO5P.2Na/c1-8(12)11-10(7-16-17(13,14)15)9-5-3-2-4-6-9;;/h2-6,10H,7H2,1H3,(H,11,12)(H2,13,14,15);;/q;2*+1/p-2/t10-;;/m0../s1.
What are the key properties of disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate?
disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate has a molecular weight of 303.16 g/mol, XLogP of -6.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[(2R)-2-acetamido-2-phenylethyl] phosphate is sourced from PubChem (CID 18339794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).