About N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide
N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide (PubChem CID 18340126) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide |
| PubChem CID | 18340126 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide |
| SMILES | CC(=O)NCCCN1CC(C)(C)CNC1=O |
| InChI | InChI=1S/C11H21N3O2/c1-9(15)12-5-4-6-14-8-11(2,3)7-13-10(14)16/h4-8H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | QRQFJDKLYMZJRF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide?
The IUPAC name of N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide (CID 18340126) is N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide.
What is the SMILES notation for N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide?
The canonical SMILES for N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide is CC(=O)NCCCN1CC(C)(C)CNC1=O.
What is the InChIKey of N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide?
The InChIKey is QRQFJDKLYMZJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-9(15)12-5-4-6-14-8-11(2,3)7-13-10(14)16/h4-8H2,1-3H3,(H,12,15)(H,13,16).
What are the key properties of N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide?
N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide has a molecular weight of 227.31 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5,5-dimethyl-2-oxo-1,3-diazinan-1-yl)propyl]acetamide is sourced from PubChem (CID 18340126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).