C17H33N3O — CID 18340166
N-[4-[(2R,6S)-2,6-dimethylpiperidin-1-yl]butyl]piperidine-2-carboxamide (PubChem CID 18340166) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylpiperidin-1-yl]butyl]piperidine-2-carboxamide.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylpiperidin-1-yl]butyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 18340166 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylpiperidin-1-yl]butyl]piperidine-2-carboxamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCNC(=O)C1CCCCN1 |
| InChI | InChI=1S/C17H33N3O/c1-14-8-7-9-15(2)20(14)13-6-5-12-19-17(21)16-10-3-4-11-18-16/h14-16,18H,3-13H2,1-2H3,(H,19,21)/t14-,15+,16? |
| InChIKey | QKEUZFFQJXPSMM-XYPWUTKMSA-N |
| XLogP | 2.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|