About 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol
1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol (PubChem CID 18340604) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol.
Molecular Properties
| Compound Name | 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol |
| PubChem CID | 18340604 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol |
| SMILES | CN1CCC2(CC1)CC(O)c1ccccc12 |
| InChI | InChI=1S/C14H19NO/c1-15-8-6-14(7-9-15)10-13(16)11-4-2-3-5-12(11)14/h2-5,13,16H,6-10H2,1H3 |
| InChIKey | FDUBTYYODNLRFW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The IUPAC name of 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol (CID 18340604) is 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol.
What is the SMILES notation for 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The canonical SMILES for 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol is CN1CCC2(CC1)CC(O)c1ccccc12.
What is the InChIKey of 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The InChIKey is FDUBTYYODNLRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-15-8-6-14(7-9-15)10-13(16)11-4-2-3-5-12(11)14/h2-5,13,16H,6-10H2,1H3.
What are the key properties of 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol has a molecular weight of 217.31 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol is sourced from PubChem (CID 18340604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).