C14H13F3N5O6S- — CID 18340944
N-(4,6-dimethoxypyrimidin-2-yl)-N'-[[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]sulfonyl]carbamimidate (PubChem CID 18340944) has the molecular formula C14H13F3N5O6S- and a molecular weight of 436.35 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-N'-[[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]sulfonyl]carbamimidate.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-N'-[[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]sulfonyl]carbamimidate |
|---|---|
| PubChem CID | 18340944 |
| Molecular Formula | C14H13F3N5O6S- |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-N'-[[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]sulfonyl]carbamimidate |
| SMILES | COc1cc(OC)nc(N/C([O-])=N\S(=O)(=O)c2ncccc2OCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H14F3N5O6S/c1-26-9-6-10(27-2)20-12(19-9)21-13(23)22-29(24,25)11-8(4-3-5-18-11)28-7-14(15,16)17/h3-6H,7H2,1-2H3,(H2,19,20,21,22,23)/p-1 |
| InChIKey | AIMMSOZBPYFASU-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|