C35H42N6O4 — CID 18341208
(2,4,6-trimethylcyclohexyl) 2-[3-[(2,5-dimethylphenoxy)methylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18341208) has the molecular formula C35H42N6O4 and a molecular weight of 610.76 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[(2,5-dimethylphenoxy)methylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2,5-dimethylphenoxy)methylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18341208 |
| Molecular Formula | C35H42N6O4 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2,5-dimethylphenoxy)methylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(N4CCOCC4)c(NCOc4cc(C)ccc4C)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C35H42N6O4/c1-21-7-8-23(3)30(17-21)44-20-37-27-18-26(9-10-29(27)40-11-13-43-14-12-40)33-38-34-31(28(36-6)19-41(34)39-33)35(42)45-32-24(4)15-22(2)16-25(32)5/h7-10,17-19,22,24-25,32,37H,11-16,20H2,1-5H3,(H,38,39) |
| InChIKey | NLFQKIRTPZJYTR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|