C32H39N7O7 — CID 18341211
(2,4,6-trimethylcyclohexyl) 2-[4-[4-(4-ethoxy-4-oxobutanoyl)piperazin-1-yl]-3-nitrophenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18341211) has the molecular formula C32H39N7O7 and a molecular weight of 633.71 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[4-[4-(4-ethoxy-4-oxobutanoyl)piperazin-1-yl]-3-nitrophenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[4-[4-(4-ethoxy-4-oxobutanoyl)piperazin-1-yl]-3-nitrophenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18341211 |
| Molecular Formula | C32H39N7O7 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[4-[4-(4-ethoxy-4-oxobutanoyl)piperazin-1-yl]-3-nitrophenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(N4CCN(C(=O)CCC(=O)OCC)CC4)c([N+](=O)[O-])c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C32H39N7O7/c1-6-45-27(41)10-9-26(40)37-13-11-36(12-14-37)24-8-7-22(17-25(24)39(43)44)30-34-31-28(23(33-5)18-38(31)35-30)32(42)46-29-20(3)15-19(2)16-21(29)4/h7-8,17-21,29H,6,9-16H2,1-4H3,(H,34,35) |
| InChIKey | YKLLIBYHPQZQSO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|