C37H45N7O4 — CID 18341212
(2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2,5-dimethylphenoxy)methylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18341212) has the molecular formula C37H45N7O4 and a molecular weight of 651.81 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2,5-dimethylphenoxy)methylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2,5-dimethylphenoxy)methylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18341212 |
| Molecular Formula | C37H45N7O4 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.35 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2,5-dimethylphenoxy)methylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(N4CCN(C(C)=O)CC4)c(NCOc4cc(C)ccc4C)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C37H45N7O4/c1-22-8-9-24(3)32(18-22)47-21-39-29-19-28(10-11-31(29)43-14-12-42(13-15-43)27(6)45)35-40-36-33(30(38-7)20-44(36)41-35)37(46)48-34-25(4)16-23(2)17-26(34)5/h8-11,18-20,23,25-26,34,39H,12-17,21H2,1-6H3,(H,40,41) |
| InChIKey | PUUUSMJNANZDJB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|