About N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide
N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide (PubChem CID 18341635) has the molecular formula C9H17BN2O3
and a molecular weight of 212.06 g/mol. Its IUPAC name is N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide.
Molecular Properties
| Compound Name | N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide |
| PubChem CID | 18341635 |
| Molecular Formula | C9H17BN2O3 |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide |
| SMILES | CON(C)C(=O)C(CC(C)C)/N=C/B=O |
| InChI | InChI=1S/C9H17BN2O3/c1-7(2)5-8(11-6-10-14)9(13)12(3)15-4/h6-8H,5H2,1-4H3/b11-6+ |
| InChIKey | RRSHNAXBBKYNJA-IZZDOVSWSA-N |
| XLogP | 0.50 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide?
The IUPAC name of N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide (CID 18341635) is N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide.
What is the SMILES notation for N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide?
The canonical SMILES for N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide is CON(C)C(=O)C(CC(C)C)/N=C/B=O.
What is the InChIKey of N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide?
The InChIKey is RRSHNAXBBKYNJA-IZZDOVSWSA-N. The full InChI is InChI=1S/C9H17BN2O3/c1-7(2)5-8(11-6-10-14)9(13)12(3)15-4/h6-8H,5H2,1-4H3/b11-6+.
What are the key properties of N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide?
N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide has a molecular weight of 212.06 g/mol, XLogP of 0.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,4-dimethyl-2-(oxoboranylmethylideneamino)pentanamide is sourced from PubChem (CID 18341635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).