C5H13N3S — CID 18341687
1,4,5-trimethyl-1,2,4-triazolidin-4-ium-3-thiolate (PubChem CID 18341687) has the molecular formula C5H13N3S and a molecular weight of 147.25 g/mol. Its IUPAC name is 1,4,5-trimethyl-1,2,4-triazolidin-4-ium-3-thiolate.
| Compound Name | 1,4,5-trimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
|---|---|
| PubChem CID | 18341687 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1,4,5-trimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
| SMILES | CC1N(C)NC([S-])[NH+]1C |
| InChI | InChI=1S/C5H13N3S/c1-4-7(2)5(9)6-8(4)3/h4-6,9H,1-3H3 |
| InChIKey | NKCUSFFPYGNZIH-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|