About 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate
4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate (PubChem CID 18341803) has the molecular formula C4H12N4S
and a molecular weight of 148.23 g/mol. Its IUPAC name is 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate.
Molecular Properties
| Compound Name | 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate |
| PubChem CID | 18341803 |
| Molecular Formula | C4H12N4S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate |
| SMILES | CCN1C[NH+](N)C([S-])N1 |
| InChI | InChI=1S/C4H12N4S/c1-2-7-3-8(5)4(9)6-7/h4,6,9H,2-3,5H2,1H3 |
| InChIKey | HMOHWZYNUMANCR-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate?
The IUPAC name of 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate (CID 18341803) is 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate.
What is the SMILES notation for 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate?
The canonical SMILES for 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate is CCN1C[NH+](N)C([S-])N1.
What is the InChIKey of 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate?
The InChIKey is HMOHWZYNUMANCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N4S/c1-2-7-3-8(5)4(9)6-7/h4,6,9H,2-3,5H2,1H3.
What are the key properties of 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate?
4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate has a molecular weight of 148.23 g/mol, XLogP of -2.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-ethyl-1,2,4-triazolidin-4-ium-3-thiolate is sourced from PubChem (CID 18341803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).