C6H15N3S — CID 18341829
4-ethyl-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate (PubChem CID 18341829) has the molecular formula C6H15N3S and a molecular weight of 161.27 g/mol. Its IUPAC name is 4-ethyl-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate.
| Compound Name | 4-ethyl-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
|---|---|
| PubChem CID | 18341829 |
| Molecular Formula | C6H15N3S |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-ethyl-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
| SMILES | CC[NH+]1C([S-])NN(C)C1C |
| InChI | InChI=1S/C6H15N3S/c1-4-9-5(2)8(3)7-6(9)10/h5-7,10H,4H2,1-3H3 |
| InChIKey | KNPBWRZZLSABJP-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|