About 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate
4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate (PubChem CID 18341831) has the molecular formula C5H13N3S
and a molecular weight of 147.25 g/mol. Its IUPAC name is 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate.
Molecular Properties
| Compound Name | 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate |
| PubChem CID | 18341831 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate |
| SMILES | CC[NH+]1CN(C)NC1[S-] |
| InChI | InChI=1S/C5H13N3S/c1-3-8-4-7(2)6-5(8)9/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | GSUXLFDRDYPBHW-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate?
The IUPAC name of 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate (CID 18341831) is 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate.
What is the SMILES notation for 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate?
The canonical SMILES for 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate is CC[NH+]1CN(C)NC1[S-].
What is the InChIKey of 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate?
The InChIKey is GSUXLFDRDYPBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3S/c1-3-8-4-7(2)6-5(8)9/h5-6,9H,3-4H2,1-2H3.
What are the key properties of 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate?
4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate has a molecular weight of 147.25 g/mol, XLogP of -1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-methyl-1,2,4-triazolidin-4-ium-3-thiolate is sourced from PubChem (CID 18341831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).