C25H48N+ — CID 18341883
6-(2,4-ditert-butylcyclopenta-2,4-dien-1-yl)hexyl-triethylazanium (PubChem CID 18341883) has the molecular formula C25H48N+ and a molecular weight of 362.67 g/mol. Its IUPAC name is 6-(2,4-ditert-butylcyclopenta-2,4-dien-1-yl)hexyl-triethylazanium.
| Compound Name | 6-(2,4-ditert-butylcyclopenta-2,4-dien-1-yl)hexyl-triethylazanium |
|---|---|
| PubChem CID | 18341883 |
| Molecular Formula | C25H48N+ |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.38 |
| IUPAC Name | 6-(2,4-ditert-butylcyclopenta-2,4-dien-1-yl)hexyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCCCCCC1C=C(C(C)(C)C)C=C1C(C)(C)C |
| InChI | InChI=1S/C25H48N/c1-10-26(11-2,12-3)18-16-14-13-15-17-21-19-22(24(4,5)6)20-23(21)25(7,8)9/h19-21H,10-18H2,1-9H3/q+1 |
| InChIKey | WRHADRUYSIOOMW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|