About 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate
2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate (PubChem CID 18342049) has the molecular formula C23H32ClN3O4S
and a molecular weight of 482.05 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate.
Molecular Properties
| Compound Name | 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate |
| PubChem CID | 18342049 |
| Molecular Formula | C23H32ClN3O4S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate |
| SMILES | CCc1cc(N(CC)CC)c(C)c(CC)c1NC(=O)OCCS(=O)(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C23H32ClN3O4S/c1-6-17-14-20(27(8-3)9-4)16(5)19(7-2)22(17)26-23(28)31-12-13-32(29,30)21-11-10-18(24)15-25-21/h10-11,14-15H,6-9,12-13H2,1-5H3,(H,26,28) |
| InChIKey | NWFKMVZCVOKQLW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate?
The IUPAC name of 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate (CID 18342049) is 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate.
What is the SMILES notation for 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate?
The canonical SMILES for 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate is CCc1cc(N(CC)CC)c(C)c(CC)c1NC(=O)OCCS(=O)(=O)c1ccc(Cl)cn1.
What is the InChIKey of 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate?
The InChIKey is NWFKMVZCVOKQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32ClN3O4S/c1-6-17-14-20(27(8-3)9-4)16(5)19(7-2)22(17)26-23(28)31-12-13-32(29,30)21-11-10-18(24)15-25-21/h10-11,14-15H,6-9,12-13H2,1-5H3,(H,26,28).
What are the key properties of 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate?
2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate has a molecular weight of 482.05 g/mol, XLogP of 5.04, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-2-pyridinyl)sulfonyl]ethyl N-[4-(diethylamino)-2,6-diethyl-3-methylphenyl]carbamate is sourced from PubChem (CID 18342049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).