About 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one
4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one (PubChem CID 18342066) has the molecular formula C9H15N3O3S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one |
| PubChem CID | 18342066 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one |
| SMILES | Cc1c(N)c(=O)n(C2CCS(=O)(=O)C2)n1C |
| InChI | InChI=1S/C9H15N3O3S/c1-6-8(10)9(13)12(11(6)2)7-3-4-16(14,15)5-7/h7H,3-5,10H2,1-2H3 |
| InChIKey | RLUZGAKJJDCKBS-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one?
The IUPAC name of 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one (CID 18342066) is 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one.
What is the SMILES notation for 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one?
The canonical SMILES for 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one is Cc1c(N)c(=O)n(C2CCS(=O)(=O)C2)n1C.
What is the InChIKey of 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one?
The InChIKey is RLUZGAKJJDCKBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3S/c1-6-8(10)9(13)12(11(6)2)7-3-4-16(14,15)5-7/h7H,3-5,10H2,1-2H3.
What are the key properties of 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one?
4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one has a molecular weight of 245.30 g/mol, XLogP of -0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrazol-3-one is sourced from PubChem (CID 18342066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).