About N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine (PubChem CID 18343053) has the molecular formula C11H12N4S
and a molecular weight of 232.31 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine |
| PubChem CID | 18343053 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1cc(NC2=NCCN2)cc2scnc12 |
| InChI | InChI=1S/C11H12N4S/c1-7-4-8(15-11-12-2-3-13-11)5-9-10(7)14-6-16-9/h4-6H,2-3H2,1H3,(H2,12,13,15) |
| InChIKey | DAOJWDFVYMTADZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine (CID 18343053) is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine is Cc1cc(NC2=NCCN2)cc2scnc12.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine?
The InChIKey is DAOJWDFVYMTADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4S/c1-7-4-8(15-11-12-2-3-13-11)5-9-10(7)14-6-16-9/h4-6H,2-3H2,1H3,(H2,12,13,15).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine?
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine has a molecular weight of 232.31 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-benzothiazol-6-amine is sourced from PubChem (CID 18343053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).