About 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol
5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol (PubChem CID 18343519) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol |
| PubChem CID | 18343519 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol |
| SMILES | CCC1C(C)OC(COC)C(C)C1O |
| InChI | InChI=1S/C11H22O3/c1-5-9-8(3)14-10(6-13-4)7(2)11(9)12/h7-12H,5-6H2,1-4H3 |
| InChIKey | JEGHENNRGRISAM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol?
The IUPAC name of 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol (CID 18343519) is 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol.
What is the SMILES notation for 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol?
The canonical SMILES for 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol is CCC1C(C)OC(COC)C(C)C1O.
What is the InChIKey of 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol?
The InChIKey is JEGHENNRGRISAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-5-9-8(3)14-10(6-13-4)7(2)11(9)12/h7-12H,5-6H2,1-4H3.
What are the key properties of 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol?
5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol has a molecular weight of 202.29 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-(methoxymethyl)-3,6-dimethyloxan-4-ol is sourced from PubChem (CID 18343519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).