About 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole
5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (PubChem CID 18343529) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| PubChem CID | 18343529 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| SMILES | CN1Cc2cn[nH]c2C1 |
| InChI | InChI=1S/C6H9N3/c1-9-3-5-2-7-8-6(5)4-9/h2H,3-4H2,1H3,(H,7,8) |
| InChIKey | YKOOTMZPXIYQED-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The IUPAC name of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (CID 18343529) is 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The canonical SMILES for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is CN1Cc2cn[nH]c2C1.
What is the InChIKey of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The InChIKey is YKOOTMZPXIYQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-9-3-5-2-7-8-6(5)4-9/h2H,3-4H2,1H3,(H,7,8).
What are the key properties of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole has a molecular weight of 123.16 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 18343529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).