C15H19FN6O7S2 — CID 18343793
3-amino-5-[[4-[2-(2-ethenoxysulfinylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-hydroxybenzenesulfonic acid (PubChem CID 18343793) has the molecular formula C15H19FN6O7S2 and a molecular weight of 478.48 g/mol. Its IUPAC name is 3-amino-5-[[4-[2-(2-ethenoxysulfinylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-amino-5-[[4-[2-(2-ethenoxysulfinylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 18343793 |
| Molecular Formula | C15H19FN6O7S2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 3-amino-5-[[4-[2-(2-ethenoxysulfinylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-hydroxybenzenesulfonic acid |
| SMILES | C=COS(=O)CCOCCNc1nc(F)nc(Nc2cc(S(=O)(=O)O)cc(N)c2O)n1 |
| InChI | InChI=1S/C15H19FN6O7S2/c1-2-29-30(24)6-5-28-4-3-18-14-20-13(16)21-15(22-14)19-11-8-9(31(25,26)27)7-10(17)12(11)23/h2,7-8,23H,1,3-6,17H2,(H,25,26,27)(H2,18,19,20,21,22) |
| InChIKey | JYGJLNQDDJAODU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 198.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|