C7H4F4O — CID 18344090
1-(difluoromethoxy)-2,4-difluorobenzene (PubChem CID 18344090) has the molecular formula C7H4F4O and a molecular weight of 180.10 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2,4-difluorobenzene.
| Compound Name | 1-(difluoromethoxy)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 18344090 |
| Molecular Formula | C7H4F4O |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 1-(difluoromethoxy)-2,4-difluorobenzene |
| SMILES | Fc1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C7H4F4O/c8-4-1-2-6(5(9)3-4)12-7(10)11/h1-3,7H |
| InChIKey | WGYLZEWBJOJPFB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |