C17H21F5O2 — CID 18344117
2-[1,1-difluoro-2-(3,4,5-trifluorophenyl)ethyl]-5-pentyl-1,3-dioxane (PubChem CID 18344117) has the molecular formula C17H21F5O2 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[1,1-difluoro-2-(3,4,5-trifluorophenyl)ethyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[1,1-difluoro-2-(3,4,5-trifluorophenyl)ethyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 18344117 |
| Molecular Formula | C17H21F5O2 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[1,1-difluoro-2-(3,4,5-trifluorophenyl)ethyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(C(F)(F)Cc2cc(F)c(F)c(F)c2)OC1 |
| InChI | InChI=1S/C17H21F5O2/c1-2-3-4-5-11-9-23-16(24-10-11)17(21,22)8-12-6-13(18)15(20)14(19)7-12/h6-7,11,16H,2-5,8-10H2,1H3 |
| InChIKey | VPYWDZVJVRICBY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|