About 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane
2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane (PubChem CID 18344142) has the molecular formula C13H23FS2
and a molecular weight of 262.46 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane |
| PubChem CID | 18344142 |
| Molecular Formula | C13H23FS2 |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane |
| SMILES | CC1CCC(C2CSC(CCF)SC2)CC1 |
| InChI | InChI=1S/C13H23FS2/c1-10-2-4-11(5-3-10)12-8-15-13(6-7-14)16-9-12/h10-13H,2-9H2,1H3 |
| InChIKey | DDWRZTXYIULYKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane?
The IUPAC name of 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane (CID 18344142) is 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane.
What is the SMILES notation for 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane?
The canonical SMILES for 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane is CC1CCC(C2CSC(CCF)SC2)CC1.
What is the InChIKey of 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane?
The InChIKey is DDWRZTXYIULYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23FS2/c1-10-2-4-11(5-3-10)12-8-15-13(6-7-14)16-9-12/h10-13H,2-9H2,1H3.
What are the key properties of 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane?
2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane has a molecular weight of 262.46 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethyl)-5-(4-methylcyclohexyl)-1,3-dithiane is sourced from PubChem (CID 18344142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).