About 1-ethyl-3a,7a-dihydrobenzimidazole
1-ethyl-3a,7a-dihydrobenzimidazole (PubChem CID 18345221) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-ethyl-3a,7a-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-ethyl-3a,7a-dihydrobenzimidazole |
| PubChem CID | 18345221 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-ethyl-3a,7a-dihydrobenzimidazole |
| SMILES | CCN1C=NC2C=CC=CC21 |
| InChI | InChI=1S/C9H12N2/c1-2-11-7-10-8-5-3-4-6-9(8)11/h3-9H,2H2,1H3 |
| InChIKey | JUSVYNXIFGHHJJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3a,7a-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3a,7a-dihydrobenzimidazole?
The IUPAC name of 1-ethyl-3a,7a-dihydrobenzimidazole (CID 18345221) is 1-ethyl-3a,7a-dihydrobenzimidazole.
What is the SMILES notation for 1-ethyl-3a,7a-dihydrobenzimidazole?
The canonical SMILES for 1-ethyl-3a,7a-dihydrobenzimidazole is CCN1C=NC2C=CC=CC21.
What is the InChIKey of 1-ethyl-3a,7a-dihydrobenzimidazole?
The InChIKey is JUSVYNXIFGHHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-11-7-10-8-5-3-4-6-9(8)11/h3-9H,2H2,1H3.
What are the key properties of 1-ethyl-3a,7a-dihydrobenzimidazole?
1-ethyl-3a,7a-dihydrobenzimidazole has a molecular weight of 148.21 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3a,7a-dihydrobenzimidazole is sourced from PubChem (CID 18345221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).