C26H27N5O4S — CID 18345259
2-[(4-tert-butylbenzoyl)amino]-N-(1H-indazol-6-yl)-4-[methoxy(sulfanyloxy)amino]benzamide (PubChem CID 18345259) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-N-(1H-indazol-6-yl)-4-[methoxy(sulfanyloxy)amino]benzamide.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-N-(1H-indazol-6-yl)-4-[methoxy(sulfanyloxy)amino]benzamide |
|---|---|
| PubChem CID | 18345259 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-N-(1H-indazol-6-yl)-4-[methoxy(sulfanyloxy)amino]benzamide |
| SMILES | CON(OS)c1ccc(C(=O)Nc2ccc3cn[nH]c3c2)c(NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H27N5O4S/c1-26(2,3)18-8-5-16(6-9-18)24(32)29-23-14-20(31(34-4)35-36)11-12-21(23)25(33)28-19-10-7-17-15-27-30-22(17)13-19/h5-15,36H,1-4H3,(H,27,30)(H,28,33)(H,29,32) |
| InChIKey | VGRZXFKQFQSKLU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|