About actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one
actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one (PubChem CID 18345684) has the molecular formula C13H18AcO3
and a molecular weight of 449.28 g/mol. Its IUPAC name is actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one.
Molecular Properties
| Compound Name | actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one |
| PubChem CID | 18345684 |
| Molecular Formula | C13H18AcO3 |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one |
| SMILES | O=C1OCCC1C(O)CC1CC2C=CC1C2.[Ac] |
| InChI | InChI=1S/C13H18O3.Ac/c14-12(11-3-4-16-13(11)15)7-10-6-8-1-2-9(10)5-8;/h1-2,8-12,14H,3-7H2; |
| InChIKey | SVXLMQXUHSWFPJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one?
The IUPAC name of actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one (CID 18345684) is actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one.
What is the SMILES notation for actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one?
The canonical SMILES for actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one is O=C1OCCC1C(O)CC1CC2C=CC1C2.[Ac].
What is the InChIKey of actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one?
The InChIKey is SVXLMQXUHSWFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3.Ac/c14-12(11-3-4-16-13(11)15)7-10-6-8-1-2-9(10)5-8;/h1-2,8-12,14H,3-7H2;.
What are the key properties of actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one?
actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one has a molecular weight of 449.28 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3-[2-(2-bicyclo[2.2.1]hept-5-enyl)-1-hydroxyethyl]oxolan-2-one is sourced from PubChem (CID 18345684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).