C17H22AcO3 — CID 18345697
actinium;3-[hydroxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)methyl]oxolan-2-one (PubChem CID 18345697) has the molecular formula C17H22AcO3 and a molecular weight of 501.36 g/mol. Its IUPAC name is actinium;3-[hydroxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)methyl]oxolan-2-one.
| Compound Name | actinium;3-[hydroxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 18345697 |
| Molecular Formula | C17H22AcO3 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | actinium;3-[hydroxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)methyl]oxolan-2-one |
| SMILES | O=C1OCCC1C(O)C1CC2CC1C1C3C=CC(C3)C21.[Ac] |
| InChI | InChI=1S/C17H22O3.Ac/c18-16(11-3-4-20-17(11)19)13-7-10-6-12(13)15-9-2-1-8(5-9)14(10)15;/h1-2,8-16,18H,3-7H2; |
| InChIKey | VFAKMBGKCJZLOG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|