About (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate
(1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate (PubChem CID 18345751) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate |
| PubChem CID | 18345751 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate |
| SMILES | CCC1(OC(=O)C2OC2C2CC3C=CC2C3)CCCCC1 |
| InChI | InChI=1S/C18H26O3/c1-2-18(8-4-3-5-9-18)21-17(19)16-15(20-16)14-11-12-6-7-13(14)10-12/h6-7,12-16H,2-5,8-11H2,1H3 |
| InChIKey | JFBXHIALNPFEPU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate?
The IUPAC name of (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate (CID 18345751) is (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate.
What is the SMILES notation for (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate?
The canonical SMILES for (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate is CCC1(OC(=O)C2OC2C2CC3C=CC2C3)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate?
The InChIKey is JFBXHIALNPFEPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-2-18(8-4-3-5-9-18)21-17(19)16-15(20-16)14-11-12-6-7-13(14)10-12/h6-7,12-16H,2-5,8-11H2,1H3.
What are the key properties of (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate?
(1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate has a molecular weight of 290.40 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl) 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate is sourced from PubChem (CID 18345751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).