C27H33FN8O5 — CID 18345963
(2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-(3-fluoro-4-hydroxyanilino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 18345963) has the molecular formula C27H33FN8O5 and a molecular weight of 568.61 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-(3-fluoro-4-hydroxyanilino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-(3-fluoro-4-hydroxyanilino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 18345963 |
| Molecular Formula | C27H33FN8O5 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-(3-fluoro-4-hydroxyanilino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(Nc5ccc(O)c(F)c5)nc(NCCN5CCCCC5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C27H33FN8O5/c1-2-15-13-19(41-34-15)23-21(38)22(39)26(40-23)36-14-30-20-24(31-16-6-7-18(37)17(28)12-16)32-27(33-25(20)36)29-8-11-35-9-4-3-5-10-35/h6-7,12-14,21-23,26,37-39H,2-5,8-11H2,1H3,(H2,29,31,32,33)/t21-,22+,23+,26+/m0/s1 |
| InChIKey | NZSQLZFWQKBZMV-NZCWTCFWSA-N |
| XLogP | 2.85 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|