C10H9N3O2 — CID 18345973
(5E)-5-[(4-aminophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 18345973) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is (5E)-5-[(4-aminophenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-aminophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18345973 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (5E)-5-[(4-aminophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | Nc1ccc(/C=C2/NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C10H9N3O2/c11-7-3-1-6(2-4-7)5-8-9(14)13-10(15)12-8/h1-5H,11H2,(H2,12,13,14,15)/b8-5+ |
| InChIKey | GQGFAZFYBKYVNS-VMPITWQZSA-N |
| XLogP | 0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|