C32H52O6 — CID 18345999
2-ethoxyethyl (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-1,1-diacetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 18345999) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is 2-ethoxyethyl (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-1,1-diacetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | 2-ethoxyethyl (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-1,1-diacetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 18345999 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | 2-ethoxyethyl (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-1,1-diacetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCOCCOC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@H](O)CC(C(C)=O)(C(C)=O)[C@@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H52O6/c1-7-37-16-17-38-29(36)13-8-20(2)26-11-12-27-25-10-9-23-18-24(35)19-32(21(3)33,22(4)34)31(23,6)28(25)14-15-30(26,27)5/h20,23-28,35H,7-19H2,1-6H3/t20-,23?,24+,25+,26-,27+,28+,30-,31-/m1/s1 |
| InChIKey | SGOMTDDPIYCMBK-QJQZQYEISA-N |
| XLogP | 5.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|